Products 908129-41-9
CAS 908129-41-9 is the registry number for (2S)-2-(1,3-Dioxoisoindolin-2-yl)-3,3-dimethyl-N-(8-quinolyl)butanamide, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(2S)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-N-quinolin-8-ylbutanamide (CAS 908129-41-9) is a chemical compound with the molecular formula C23H21N3O3 and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-N-quinolin-8-ylbutanamide. InChIKey: NYESLBHRAVNQOB-LJQANCHMSA-N.
| Molecular formula | C23H21N3O3 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-N-quinolin-8-ylbutanamide |
| InChIKey | NYESLBHRAVNQOB-LJQANCHMSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)NC1=CC=CC2=C1N=CC=C2)N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)