CAS 76629-10-2 appears in our catalog under these names: 7-Chloro-2,3-dihydro-1,8-naphthyridin-4(1h)-one, 95%, 7–Chloro–2,3–dihydro–1,8–naphthyridin–4(1H)–one, 7-Chloro-2,3-dihydro-1,8-naphthyridin-4(1H)-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 50mg.
7-chloro-2,3-dihydro-1H-1,8-naphthyridin-4-one (CAS 76629-10-2) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1H-1,8-naphthyridin-4-one. InChIKey: CUDIJCORCZREIG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1H-1,8-naphthyridin-4-one |
| InChIKey | CUDIJCORCZREIG-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=CC(=N2)Cl |
Computed by PubChem (NCBI)