Products 766526-41-4
CAS 766526-41-4 is the registry number for (3,5-dimethylphenyl)(4-methylpiperazin-1-yl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3,5-dimethylphenyl)-(4-methylpiperazin-1-yl)methanone (CAS 766526-41-4) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: (3,5-dimethylphenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: COWFNBFSVSSGLV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (3,5-dimethylphenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | COWFNBFSVSSGLV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N2CCN(CC2)C)C |
Computed by PubChem (NCBI)