CAS 76689-64-0 appears in our catalog under these names: 5-Amino-1,3-dimethyl-4-nitropyrazole, 95%, 1,3-Dimethyl-4-nitro-1H-pyrazol-5-amine, 97%, 1,3-Dimethyl-4-nitro-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3-dimethyl-4-nitropyrazol-5-amine (CAS 76689-64-0) is a chemical compound with the molecular formula C5H8N4O2 and a molecular weight of 156.14 g/mol. IUPAC name: 1,3-dimethyl-4-nitropyrazol-5-amine. InChIKey: BSUSGJKEVOQESO-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O2 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | 1,3-dimethyl-4-nitropyrazol-5-amine |
| InChIKey | BSUSGJKEVOQESO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)