CAS 2137086-50-9 appears in our catalog under these names: (2R,4S)-4-Azidopyrrolidine-2-carboxylic acid hydrochloride, 95%, H-D-Pro(4-N3)-OH*HCl (2R,4S), (2R,4S)-H-D-Pro(4-N3)-OH. Offered by: Combi-blocks, Iris Biotech, MedChemExpress. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg, 500mg, Get quote.
(2R,4S)-4-azidopyrrolidine-2-carboxylic acid (CAS 2137086-50-9) is a chemical compound with the molecular formula C5H8N4O2 and a molecular weight of 156.14 g/mol. IUPAC name: (2R,4S)-4-azidopyrrolidine-2-carboxylic acid. InChIKey: PPRFZPZRQYPCER-IUYQGCFVSA-N.
| Molecular formula | C5H8N4O2 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | (2R,4S)-4-azidopyrrolidine-2-carboxylic acid |
| InChIKey | PPRFZPZRQYPCER-IUYQGCFVSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)