CAS 7669-84-3 appears in our catalog under these names: H-Cys(Bzl)-Gly-OH, H–Cys(Bzl)–Gly–OH, H-Cys(Bzl)-Gly-OH trifluoroacetic acid. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 0,25g.
2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetic acid (CAS 7669-84-3) is a chemical compound with the molecular formula C12H16N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetic acid. InChIKey: JBOHJUDJUVTRCF-JTQLQIEISA-N.
| Molecular formula | C12H16N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetic acid |
| InChIKey | JBOHJUDJUVTRCF-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)