CAS 76738-75-5 is the registry number for (+)-Anymol, >95% (GC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 2,5mg.
(+)-epi-alpha-bisabolol is a sesquiterpenoid that is bisabolane having double bonds at positions 2 and 9 as well as a hydroxy substituent at position 7. It derives from a hydride of a bisabolane.
Source: ChEBI
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (2S)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| InChIKey | RGZSQWQPBWRIAQ-GJZGRUSLSA-N |
| SMILES | CC1=CC[C@@H](CC1)[C@](C)(CCC=C(C)C)O |
Computed by PubChem (NCBI)