CAS 78148-59-1 appears in our catalog under these names: (-)-Anymol, >95% (GC), (-)-Anymol. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg.
(2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol (CAS 78148-59-1) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol. InChIKey: RGZSQWQPBWRIAQ-HUUCEWRRSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (2R)-6-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| InChIKey | RGZSQWQPBWRIAQ-HUUCEWRRSA-N |
| SMILES | CC1=CC[C@H](CC1)[C@@](C)(CCC=C(C)C)O |
Computed by PubChem (NCBI)