CAS 768335-16-6 is the registry number for 3-(2,2,2-Trifluoroethyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2,2-trifluoroethyl)aniline (CAS 768335-16-6) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)aniline. InChIKey: FHLUOUXEXWHPHZ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethyl)aniline |
| InChIKey | FHLUOUXEXWHPHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CC(F)(F)F |
Computed by PubChem (NCBI)