CAS 76905-80-1 appears in our catalog under these names: 2,2’-Diiodo-1,1’-binaphthalene, 2,2'-Diiodo-1,1'-binaphthalene, 97%. Offered by: TRC, AmBeed. Available pack sizes: 500mg, 5g.
2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene (CAS 76905-80-1) is a chemical compound with the molecular formula C20H12I2 and a molecular weight of 506.1 g/mol. IUPAC name: 2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene. InChIKey: KZSPPDFSBAVQBI-UHFFFAOYSA-N.
| Molecular formula | C20H12I2 |
|---|---|
| Molecular weight | 506.1 g/mol |
| IUPAC name | 2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene |
| InChIKey | KZSPPDFSBAVQBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)I)I |
Computed by PubChem (NCBI)