CAS 86688-07-5 appears in our catalog under these names: 1,1'-Binaphthalene, 2,2'-diiodo-, (1r)-, 95%, (S)–2,2'–diiodo–1,1'–binaphthalene, (S)-2,2'-Diiodo-1,1'-binaphthalene, 95+%, 95+%, (S)-2,2'-diiodo-1,1'-binaphthalene, 95+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene (CAS 86688-07-5) is a chemical compound with the molecular formula C20H12I2 and a molecular weight of 506.1 g/mol. IUPAC name: 2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene. InChIKey: KZSPPDFSBAVQBI-UHFFFAOYSA-N.
| Molecular formula | C20H12I2 |
|---|---|
| Molecular weight | 506.1 g/mol |
| IUPAC name | 2-iodo-1-(2-iodonaphthalen-1-yl)naphthalene |
| InChIKey | KZSPPDFSBAVQBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)I)I |
Computed by PubChem (NCBI)