Products 76924-94-2

CAS 76924-94-2 is the registry number for Ethyl 3-(1,3-Dioxolane)hexanoate. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-propyl-1,3-dioxolan-2-yl)acetate (CAS 76924-94-2) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: ethyl 2-(2-propyl-1,3-dioxolan-2-yl)acetate. InChIKey: AXNPDRYPXSHROR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC nameethyl 2-(2-propyl-1,3-dioxolan-2-yl)acetate
InChIKeyAXNPDRYPXSHROR-UHFFFAOYSA-N
SMILESCCCC1(OCCO1)CC(=O)OCC

Computed by PubChem (NCBI)