Products 7693-47-2

CAS 7693-47-2 is the registry number for Mesityl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2,4,6-trimethylphenyl) carbonochloridate (CAS 7693-47-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: (2,4,6-trimethylphenyl) carbonochloridate. InChIKey: CPJUZSXZARKCIM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO2
Molecular weight198.64 g/mol
IUPAC name(2,4,6-trimethylphenyl) carbonochloridate
InChIKeyCPJUZSXZARKCIM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)OC(=O)Cl)C

Computed by PubChem (NCBI)