CAS 7693-47-2 is the registry number for Mesityl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4,6-trimethylphenyl) carbonochloridate (CAS 7693-47-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: (2,4,6-trimethylphenyl) carbonochloridate. InChIKey: CPJUZSXZARKCIM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | (2,4,6-trimethylphenyl) carbonochloridate |
| InChIKey | CPJUZSXZARKCIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)OC(=O)Cl)C |
Computed by PubChem (NCBI)