CAS 76932-42-8 is the registry number for 2-Amino-3-mesitylpropanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-amino-3-(2,4,6-trimethylphenyl)propanoic acid (CAS 76932-42-8) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 2-amino-3-(2,4,6-trimethylphenyl)propanoic acid. InChIKey: CRNOZLNQYAUXRK-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-amino-3-(2,4,6-trimethylphenyl)propanoic acid |
| InChIKey | CRNOZLNQYAUXRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(C(=O)O)N)C |
Computed by PubChem (NCBI)