Products 770658-21-4

CAS 770658-21-4 is the registry number for 2-(4-Aminothiophen-3-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-aminothiophen-3-yl)acetic acid (CAS 770658-21-4) is a chemical compound with the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. IUPAC name: 2-(4-aminothiophen-3-yl)acetic acid. InChIKey: ARFYFEQALUKNBX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO2S
Molecular weight157.19 g/mol
IUPAC name2-(4-aminothiophen-3-yl)acetic acid
InChIKeyARFYFEQALUKNBX-UHFFFAOYSA-N
SMILESC1=C(C(=CS1)N)CC(=O)O

Computed by PubChem (NCBI)