CAS 772-14-5 appears in our catalog under these names: (R)-3-Phenylbutyric Acid, (R)-3-Phenylbutanoic acid 97%, (R)-3-PHENYLBUTYRIC ACID, >=98.5 % GC &, (R)-3-Phenylbutyric Acid, 97%, 97%, (R)-3-Phenylbutanoic acid, 97%. Offered by: Biosynth, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 2g, 1g, 5g, 100g, 100mg, 250mg, 25g, 1ML.
(3R)-3-phenylbutanoic acid (CAS 772-14-5) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (3R)-3-phenylbutanoic acid. InChIKey: ZZEWMYILWXCRHZ-MRVPVSSYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (3R)-3-phenylbutanoic acid |
| InChIKey | ZZEWMYILWXCRHZ-MRVPVSSYSA-N |
| SMILES | C[C@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)