CAS 772-15-6 appears in our catalog under these names: (S)-3-Phenylbutanoic acid, 97%, (S)-3-Phenylbutyric Acid, (S)-3-Phenylbutanoic acid, ≥97%, ≥97%, (S)-3-Phenylbutanoic acid, ≥97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 1g, 100mg, 250mg.
(3S)-3-phenylbutanoic acid (CAS 772-15-6) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (3S)-3-phenylbutanoic acid. InChIKey: ZZEWMYILWXCRHZ-QMMMGPOBSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (3S)-3-phenylbutanoic acid |
| InChIKey | ZZEWMYILWXCRHZ-QMMMGPOBSA-N |
| SMILES | C[C@@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)