CAS 77223-21-3 appears in our catalog under these names: 7-Chloro-2,4-dimethyl-[1,8]naphthyridine, 98%, 7-Chloro-2,4-dimethyl-1,8-naphthyridine, 97%, 7-Chloro-2,4-dimethyl-[1,8]naphthyridine, 97%, 97%, 7-Chloro-2,4-dimethyl-[1,8]naphthyridine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100mg, 500mg, 2.5g.
7-chloro-2,4-dimethyl-1,8-naphthyridine (CAS 77223-21-3) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 7-chloro-2,4-dimethyl-1,8-naphthyridine. InChIKey: HLCDGFNOHFBIMK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 7-chloro-2,4-dimethyl-1,8-naphthyridine |
| InChIKey | HLCDGFNOHFBIMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC(=N2)Cl)C |
Computed by PubChem (NCBI)