CAS 772292-30-5 is the registry number for Brivaracetam Impurity 48. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2S)-2-[[(2S)-2-aminobutanoyl]amino]butanoate (CAS 772292-30-5) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-aminobutanoyl]amino]butanoate. InChIKey: DYRQAHGUZKDGSX-BQBZGAKWSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-aminobutanoyl]amino]butanoate |
| InChIKey | DYRQAHGUZKDGSX-BQBZGAKWSA-N |
| SMILES | CC[C@@H](C(=O)N[C@@H](CC)C(=O)OC)N |
Computed by PubChem (NCBI)