CAS 772310-25-5 is the registry number for Benzyl (2R,3aS,7aR)-octahydro-1H-indole-2-caboxylate. Offered by: TRC. Available pack sizes: 100mg.
Benzyl (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate (CAS 772310-25-5) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: benzyl (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate. InChIKey: ARGCRCXTJMQKNA-QLFBSQMISA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | benzyl (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
| InChIKey | ARGCRCXTJMQKNA-QLFBSQMISA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C[C@@H](N2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)