Products 77290-43-8

CAS 77290-43-8 is the registry number for 4-(Bis(4-(dimethylamino)phenyl)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[bis[4-(dimethylamino)phenyl]methyl]benzoic acid (CAS 77290-43-8) is a chemical compound with the molecular formula C24H26N2O2 and a molecular weight of 374.5 g/mol. IUPAC name: 4-[bis[4-(dimethylamino)phenyl]methyl]benzoic acid. InChIKey: GNJAUKUSICXRTP-UHFFFAOYSA-N.

Identity
Molecular formulaC24H26N2O2
Molecular weight374.5 g/mol
IUPAC name4-[bis[4-(dimethylamino)phenyl]methyl]benzoic acid
InChIKeyGNJAUKUSICXRTP-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)N(C)C

Computed by PubChem (NCBI)