CAS 870964-69-5 is the registry number for Evocalcet Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetic acid (CAS 870964-69-5) is a chemical compound with the molecular formula C24H26N2O2 and a molecular weight of 374.5 g/mol. IUPAC name: 2-[2-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetic acid. InChIKey: BINOINQAMVMIGQ-XLIONFOSSA-N.
| Molecular formula | C24H26N2O2 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 2-[2-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetic acid |
| InChIKey | BINOINQAMVMIGQ-XLIONFOSSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N[C@H]3CCN(C3)C4=CC=CC=C4CC(=O)O |
Computed by PubChem (NCBI)