Products 773102-35-5
CAS 773102-35-5 is the registry number for 2-(4-fluoro-3-(trifluoromethyl)phenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-dioxolane (CAS 773102-35-5) is a chemical compound with the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. IUPAC name: 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-dioxolane. InChIKey: NQQDLYVJEMDLNF-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-dioxolane |
| InChIKey | NQQDLYVJEMDLNF-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)