Products 77450-00-1

CAS 77450-00-1 is the registry number for 1-(tert-Butyl) 2-ethyl (2R,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-ethyl (2R,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 77450-00-1) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MNMDZSAWTQOEHX-RKDXNWHRSA-N.

Identity
Molecular formulaC12H21NO5
Molecular weight259.30 g/mol
IUPAC name1-O-tert-butyl 2-O-ethyl (2R,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
InChIKeyMNMDZSAWTQOEHX-RKDXNWHRSA-N
SMILESCCOC(=O)[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)O

Computed by PubChem (NCBI)