CAS 774575-85-8 is the registry number for 1-BOC-4-(thiophene-2-sulfonyl)piperazine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-thiophen-2-ylsulfonylpiperazine-1-carboxylate (CAS 774575-85-8) is a chemical compound with the molecular formula C13H20N2O4S2 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 4-thiophen-2-ylsulfonylpiperazine-1-carboxylate. InChIKey: CDLDKEHFURBZIW-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 4-thiophen-2-ylsulfonylpiperazine-1-carboxylate |
| InChIKey | CDLDKEHFURBZIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)