CAS 949321-46-4 appears in our catalog under these names: N-Cyclohexyl-n-methylbenzene-1,2-disulfonamide, 95%, 1-N-Cyclohexyl-1-N-methylbenzene-1,2-disulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-N-cyclohexyl-2-N-methylbenzene-1,2-disulfonamide (CAS 949321-46-4) is a chemical compound with the molecular formula C13H20N2O4S2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-N-cyclohexyl-2-N-methylbenzene-1,2-disulfonamide. InChIKey: AAUVVCHGNHSEJG-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-N-cyclohexyl-2-N-methylbenzene-1,2-disulfonamide |
| InChIKey | AAUVVCHGNHSEJG-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)S(=O)(=O)C2=CC=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)