Products 775315-17-8
CAS 775315-17-8 is the registry number for N-[4-(Chloromethyl)-1,3-thiazol-2-yl]-n-(3,4-dimethylphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,4-dimethylphenyl)acetamide (CAS 775315-17-8) is a chemical compound with the molecular formula C14H15ClN2OS and a molecular weight of 294.8 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,4-dimethylphenyl)acetamide. InChIKey: UXJNYQJFMFFDLO-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2OS |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3,4-dimethylphenyl)acetamide |
| InChIKey | UXJNYQJFMFFDLO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N(C2=NC(=CS2)CCl)C(=O)C)C |
Computed by PubChem (NCBI)