CAS 931076-57-2 is the registry number for 1-(4-(5-Chlorobenzo[d]thiazol-2-yl)piperidin-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]ethanone (CAS 931076-57-2) is a chemical compound with the molecular formula C14H15ClN2OS and a molecular weight of 294.8 g/mol. IUPAC name: 1-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]ethanone. InChIKey: UJKGZCJFOTUVBM-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2OS |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 1-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]ethanone |
| InChIKey | UJKGZCJFOTUVBM-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)C2=NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)