Products 776266-25-2
CAS 776266-25-2 is the registry number for 6,7-Dihydro-6-oxopyrazolo[1,5-a]pyrido[3,4-e]pyrimidine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylic acid (CAS 776266-25-2) is a chemical compound with the molecular formula C10H6N4O3 and a molecular weight of 230.18 g/mol. IUPAC name: 10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylic acid. InChIKey: YLVSNCXGLJDPHO-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O3 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylic acid |
| InChIKey | YLVSNCXGLJDPHO-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1N3C(=C(C=N3)C(=O)O)N=C2 |
Computed by PubChem (NCBI)