CAS 1018143-77-5 is the registry number for 7-(Furan-2-yl)-(1,2,4)triazolo(1,5-a)pyrimidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 1018143-77-5) is a chemical compound with the molecular formula C10H6N4O3 and a molecular weight of 230.18 g/mol. IUPAC name: 7-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: GBBYJVJLADFOAT-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O3 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 7-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | GBBYJVJLADFOAT-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=NC3=NC(=NN23)C(=O)O |
Computed by PubChem (NCBI)