CAS 1784983-15-8 is the registry number for 5-Oxo-4H,5H-(1,2,4)triazolo(1,5-a)quinazoline-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxo-4H-[1,2,4]triazolo[1,5-a]quinazoline-2-carboxylic acid (CAS 1784983-15-8) is a chemical compound with the molecular formula C10H6N4O3 and a molecular weight of 230.18 g/mol. IUPAC name: 5-oxo-4H-[1,2,4]triazolo[1,5-a]quinazoline-2-carboxylic acid. InChIKey: WZWBHTULSQQBEY-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O3 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 5-oxo-4H-[1,2,4]triazolo[1,5-a]quinazoline-2-carboxylic acid |
| InChIKey | WZWBHTULSQQBEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=NC(=NN23)C(=O)O |
Computed by PubChem (NCBI)