CAS 7763-16-8 appears in our catalog under these names: Z-Gln-onp, 95%, Z–Gln–ONp, Z-Gln-ONp. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
(4-nitrophenyl) (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate (CAS 7763-16-8) is a chemical compound with the molecular formula C19H19N3O7 and a molecular weight of 401.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate. InChIKey: KIVQPDPRDVIJDJ-INIZCTEOSA-N.
| Molecular formula | C19H19N3O7 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | KIVQPDPRDVIJDJ-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)N)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)