CAS 945618-97-3 is the registry number for (R)–(+)–m–Nitrobiphenyline oxalate. Offered by: GLPBio. Available pack sizes: 10mg.
2-[1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid (CAS 945618-97-3) is a chemical compound with the molecular formula C19H19N3O7 and a molecular weight of 401.4 g/mol. IUPAC name: 2-[1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid. InChIKey: QEAVQZOJQONCSF-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O7 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 2-[1-[2-(3-nitrophenyl)phenoxy]ethyl]-4,5-dihydro-1H-imidazole;oxalic acid |
| InChIKey | QEAVQZOJQONCSF-UHFFFAOYSA-N |
| SMILES | CC(C1=NCCN1)OC2=CC=CC=C2C3=CC(=CC=C3)[N+](=O)[O-].C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)