Products 7775-64-6
CAS 7775-64-6 is the registry number for 3-Naphthalen-1-yl-benzoic acid. Offered by: Fluorochem. Available pack sizes: 1g.
3-(2-hydroxynaphthalen-1-yl)benzoic acid (CAS 7775-64-6) is a chemical compound with the molecular formula C17H12O3 and a molecular weight of 264.27 g/mol. IUPAC name: 3-(2-hydroxynaphthalen-1-yl)benzoic acid. InChIKey: YYMXOYUYJJEIAV-UHFFFAOYSA-N.
| Molecular formula | C17H12O3 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 3-(2-hydroxynaphthalen-1-yl)benzoic acid |
| InChIKey | YYMXOYUYJJEIAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=CC(=CC=C3)C(=O)O)O |
Computed by PubChem (NCBI)