CAS 77868-40-7 appears in our catalog under these names: Ioversol Impurity 3, N-Desmethyl Iomeprol, N–Desmethyl Iomeprol, Ioversol hydrolysate-1 97%, N,N'-Bis(2,3-dihydroxypropyl)-5-[(hydroxyacetyl)amino]-2,4,6-triiodo-1,3-benzenedicarboxamide, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 500mg, 1g, 250mg, 50mg, 5g, 25g, 50 mg.
1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide (CAS 77868-40-7) is a chemical compound with the molecular formula C16H20I3N3O8 and a molecular weight of 763.06 g/mol. IUPAC name: 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide. InChIKey: ZPJJDGLVOWPGAN-UHFFFAOYSA-N.
| Molecular formula | C16H20I3N3O8 |
|---|---|
| Molecular weight | 763.06 g/mol |
| IUPAC name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
| InChIKey | ZPJJDGLVOWPGAN-UHFFFAOYSA-N |
| SMILES | C(C(CO)O)NC(=O)C1=C(C(=C(C(=C1I)NC(=O)CO)I)C(=O)NCC(CO)O)I |
Computed by PubChem (NCBI)