CAS 77868-41-8 appears in our catalog under these names: Iopamidol EP Impurity B, Iopamidol EP Impurity B (Desmethyl Iopamidol), Iopamidol Impurity 2(Iopamidol EP Impurity B), Desmethyl Iopamidol, 5-((Hydroxyacetyl)amino)-N,N'-bis (2-hydroxy-1-(hydroxymethyl)ethyl)-2,4,6-triiodo-1,3-benzenedicarboxamide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide (CAS 77868-41-8) is a chemical compound with the molecular formula C16H20I3N3O8 and a molecular weight of 763.06 g/mol. IUPAC name: 1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide. InChIKey: BPSXCZTZZDIVJV-UHFFFAOYSA-N.
| Molecular formula | C16H20I3N3O8 |
|---|---|
| Molecular weight | 763.06 g/mol |
| IUPAC name | 1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
| InChIKey | BPSXCZTZZDIVJV-UHFFFAOYSA-N |
| SMILES | C(C(CO)NC(=O)C1=C(C(=C(C(=C1I)NC(=O)CO)I)C(=O)NC(CO)CO)I)O |
Computed by PubChem (NCBI)