CAS 779323-58-9 appears in our catalog under these names: 6-Benzyl-2,4-dichloro-6,7-dihydro-5h-pyrrolo[3,4-d]pyrimidine, 95%, 6-Benzyl-2,4-dichloro-6,7-dihydro-5H-pyrrolo(3,4-d)pyrimidine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
6-benzyl-2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine (CAS 779323-58-9) is a chemical compound with the molecular formula C13H11Cl2N3 and a molecular weight of 280.15 g/mol. IUPAC name: 6-benzyl-2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine. InChIKey: RZSMZEYQFCOUKN-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N3 |
|---|---|
| Molecular weight | 280.15 g/mol |
| IUPAC name | 6-benzyl-2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine |
| InChIKey | RZSMZEYQFCOUKN-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)