CAS 89869-39-6 appears in our catalog under these names: 1,3-Bis(4-chlorophenyl)guanidine, 1,3-Bis(4-chlorophenyl)guanidine 95%. Offered by: TRC, Ambeed. Available pack sizes: 10mg, 100mg, 250mg, 1g.
1,2-bis(4-chlorophenyl)guanidine (CAS 89869-39-6) is a chemical compound with the molecular formula C13H11Cl2N3 and a molecular weight of 280.15 g/mol. IUPAC name: 1,2-bis(4-chlorophenyl)guanidine. InChIKey: RGEILJBBJKRWMV-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N3 |
|---|---|
| Molecular weight | 280.15 g/mol |
| IUPAC name | 1,2-bis(4-chlorophenyl)guanidine |
| InChIKey | RGEILJBBJKRWMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=NC2=CC=C(C=C2)Cl)N)Cl |
Computed by PubChem (NCBI)