CAS 779341-19-4 is the registry number for 3-(3-Aminophenyl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(3-aminophenyl)phenol (CAS 779341-19-4) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 3-(3-aminophenyl)phenol. InChIKey: BFTXLAFWQOHRMU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3-(3-aminophenyl)phenol |
| InChIKey | BFTXLAFWQOHRMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)