Products 77973-25-2
CAS 77973-25-2 appears in our catalog under these names: 1–(2–((Dimethylamino)methyl)–4–methoxyphenyl)ethanone, 1-(2-((Dimethylamino)methyl)-4-methoxyphenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-[2-[(dimethylamino)methyl]-4-methoxyphenyl]ethanone (CAS 77973-25-2) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 1-[2-[(dimethylamino)methyl]-4-methoxyphenyl]ethanone. InChIKey: KLUFOYLIBGBURX-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 1-[2-[(dimethylamino)methyl]-4-methoxyphenyl]ethanone |
| InChIKey | KLUFOYLIBGBURX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)CN(C)C |
Computed by PubChem (NCBI)