Products 780034-13-1
CAS 780034-13-1 appears in our catalog under these names: H-β-D-Phe(2-OMe)-OH, 98%, (R)-3-Amino-3-(2-Methoxyphenyl)Propanoic Acid, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-amino-3-(2-methoxyphenyl)propanoic acid (CAS 780034-13-1) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3R)-3-amino-3-(2-methoxyphenyl)propanoic acid. InChIKey: UAZGIQATDPCZHH-MRVPVSSYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3R)-3-amino-3-(2-methoxyphenyl)propanoic acid |
| InChIKey | UAZGIQATDPCZHH-MRVPVSSYSA-N |
| SMILES | COC1=CC=CC=C1[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(3R)-3-amino-3-(2-methoxyphenyl)propanoic acid, (R)-3-Amino-3-(2-methoxyphenyl)propanoic acid, (R)-3-Amino-3-(2-methoxy-phenyl)-propionic acid, R-3-Amino-3-(2-methoxyphenyl)propionic acid, (R)-3-Amino-3-(2-methoxyphenyl)propanoicacid, Benzenepropanoic acid, beta-amino-2-methoxy-, (betaR)- (9CI), R-2-Meo-PHA, H-D-b-Phe(2-OMe)-OH, H-D-beta-Phe(2-OMe)-OH, H-(R)-beta-Phe(2-MeO)-OH