Products 78078-41-8
CAS 78078-41-8 is the registry number for Abietatriene-3β-ol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol (CAS 78078-41-8) is a chemical compound with the molecular formula C20H30O and a molecular weight of 286.5 g/mol. IUPAC name: (2S,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol. InChIKey: WTHUMSLQUHCWCH-AQCCAAQSSA-N.
| Molecular formula | C20H30O |
|---|---|
| Molecular weight | 286.5 g/mol |
| IUPAC name | (2S,4aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| InChIKey | WTHUMSLQUHCWCH-AQCCAAQSSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)[C@]3(CC[C@@H](C(C3CC2)(C)C)O)C |
Computed by PubChem (NCBI)