Products 782-17-2
CAS 782-17-2 appears in our catalog under these names: 2-(4-Fluorophenyl)indole, 99% , 2-(4-Fluorophenyl)indole 98%, 2-(4-Fluorophenyl)indole, 98%, 2-(4-Fluorophenyl)indole, >98.0%(GC), 2-(4-Fluorophenyl)indole, 98%, 98%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
2-(4-fluorophenyl)-1H-indole (CAS 782-17-2) is a chemical compound with the molecular formula C14H10FN and a molecular weight of 211.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-1H-indole. InChIKey: VLHGDCJIDNVRFM-UHFFFAOYSA-N.
| Molecular formula | C14H10FN |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1H-indole |
| InChIKey | VLHGDCJIDNVRFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)