Products 78304-52-6
CAS 78304-52-6 is the registry number for 5-Phenoxy-1H-indole-2-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
5-phenoxy-1H-indole-2-carboxylic acid (CAS 78304-52-6) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 5-phenoxy-1H-indole-2-carboxylic acid. InChIKey: KIVFYFCCEIOXCO-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 5-phenoxy-1H-indole-2-carboxylic acid |
| InChIKey | KIVFYFCCEIOXCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)NC(=C3)C(=O)O |
Computed by PubChem (NCBI)