CAS 78304-53-7 appears in our catalog under these names: 5-Phenoxy-1H-indole, 97%, 5-Phenoxy-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg.
5-phenoxy-1H-indole (CAS 78304-53-7) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 5-phenoxy-1H-indole. InChIKey: YJBIMZVVUOJZSS-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 5-phenoxy-1H-indole |
| InChIKey | YJBIMZVVUOJZSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)