Products 78318-60-2
CAS 78318-60-2 is the registry number for 4'-(2-Hydroxyethoxy)methyl-4,5',8-trimethylpsoralen. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 5g.
3-(2-hydroxyethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one (CAS 78318-60-2) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: 3-(2-hydroxyethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one. InChIKey: RMFGDCBXXBBDHA-UHFFFAOYSA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | 3-(2-hydroxyethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| InChIKey | RMFGDCBXXBBDHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C(C3=C(C=C12)C(=C(O3)C)COCCO)C |
Computed by PubChem (NCBI)