CAS 783300-35-6 appears in our catalog under these names: (S)-3-Amino-3-(3-methoxy-phenyl)-propionic acid, 95%, (S)-3-Amino-3-(3-methoxyphenyl)propanoic acid, 98%, 98%, (S)-3-Amino-3-(3-methoxyphenyl)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
(3S)-3-amino-3-(3-methoxyphenyl)propanoic acid (CAS 783300-35-6) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3S)-3-amino-3-(3-methoxyphenyl)propanoic acid. InChIKey: FGMPGCPZEOXEES-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-methoxyphenyl)propanoic acid |
| InChIKey | FGMPGCPZEOXEES-VIFPVBQESA-N |
| SMILES | COC1=CC=CC(=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)