Products 783371-63-1
CAS 783371-63-1 appears in our catalog under these names: (2S)-3-(tert-butoxy)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid, 98%, Aloc-L-Ser(tBu)-OH*DCHA. Offered by: Chemat, Iris Biotech. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-3-[(2-methylpropan-2-yl)oxy]-2-(prop-2-enoxycarbonylamino)propanoic acid (CAS 783371-63-1) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: DDUOETOENCPAPQ-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | DDUOETOENCPAPQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)