CAS 78341-97-6 is the registry number for Methyl 5-deoxy-2,3-O-isopropylidene-D-ribofuranoside. Offered by: Biosynth. Available pack sizes: 50g, 25g.
(3aR,6R,6aR)-4-methoxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (CAS 78341-97-6) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: (3aR,6R,6aR)-4-methoxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole. InChIKey: RNHBZJGMAYMLBE-XDTPYFJJSA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (3aR,6R,6aR)-4-methoxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| InChIKey | RNHBZJGMAYMLBE-XDTPYFJJSA-N |
| SMILES | C[C@@H]1[C@@H]2[C@H](C(O1)OC)OC(O2)(C)C |
Computed by PubChem (NCBI)