CAS 78357-63-8 appears in our catalog under these names: (3,5-Dimethylphenoxy)acetyl chloride, 95%, 2-(3,5-Dimethylphenoxy)acetyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-(3,5-dimethylphenoxy)acetyl chloride (CAS 78357-63-8) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(3,5-dimethylphenoxy)acetyl chloride. InChIKey: UGOSJYWMQDHMLF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(3,5-dimethylphenoxy)acetyl chloride |
| InChIKey | UGOSJYWMQDHMLF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OCC(=O)Cl)C |
Computed by PubChem (NCBI)